C28H35N2O8S2+ — CID 23586389
6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid (PubChem CID 23586389) has the molecular formula C28H35N2O8S2+ and a molecular weight of 591.73 g/mol. Its IUPAC name is 6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 23586389 |
| Molecular Formula | C28H35N2O8S2+ |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid |
| SMILES | CC1(CCCCCC(=O)O)C(/C=C/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccc(SOOO)cc21 |
| InChI | InChI=1S/C28H34N2O8S2/c1-28(17-8-3-6-14-27(31)32)24-21-23(39-38-37-33)15-16-25(24)30(19-10-20-40(34,35)36)26(28)13-7-9-18-29-22-11-4-2-5-12-22/h2,4-5,7,9,11-13,15-16,18,21H,3,6,8,10,14,17,19-20H2,1H3,(H3,31,32,33,34,35,36)/p+1 |
| InChIKey | HFNCYVJBQPSDRZ-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 145.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|