About 2-azanidylethylazanide;chloroplatinum;methylazanide
2-azanidylethylazanide;chloroplatinum;methylazanide (PubChem CID 23586412) has the molecular formula C3H10ClN3Pt-3
and a molecular weight of 318.67 g/mol. Its IUPAC name is 2-azanidylethylazanide;chloroplatinum;methylazanide.
Molecular Properties
| Compound Name | 2-azanidylethylazanide;chloroplatinum;methylazanide |
| PubChem CID | 23586412 |
| Molecular Formula | C3H10ClN3Pt-3 |
| Molecular Weight | 318.67 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-azanidylethylazanide;chloroplatinum;methylazanide |
| SMILES | C[NH-].Cl[Pt].[NH-]CC[NH-] |
| InChI | InChI=1S/C2H6N2.CH4N.ClH.Pt/c3-1-2-4;1-2;;/h3-4H,1-2H2;2H,1H3;1H;/q-2;-1;;+1/p-1 |
| InChIKey | FZOPIPZZBSWVIX-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 71.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-azanidylethylazanide;chloroplatinum;methylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azanidylethylazanide;chloroplatinum;methylazanide?
The IUPAC name of 2-azanidylethylazanide;chloroplatinum;methylazanide (CID 23586412) is 2-azanidylethylazanide;chloroplatinum;methylazanide.
What is the SMILES notation for 2-azanidylethylazanide;chloroplatinum;methylazanide?
The canonical SMILES for 2-azanidylethylazanide;chloroplatinum;methylazanide is C[NH-].Cl[Pt].[NH-]CC[NH-].
What is the InChIKey of 2-azanidylethylazanide;chloroplatinum;methylazanide?
The InChIKey is FZOPIPZZBSWVIX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H6N2.CH4N.ClH.Pt/c3-1-2-4;1-2;;/h3-4H,1-2H2;2H,1H3;1H;/q-2;-1;;+1/p-1.
What are the key properties of 2-azanidylethylazanide;chloroplatinum;methylazanide?
2-azanidylethylazanide;chloroplatinum;methylazanide has a molecular weight of 318.67 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azanidylethylazanide;chloroplatinum;methylazanide is sourced from PubChem (CID 23586412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).