C22H17N3O2S2 — CID 23589752
3-(1-benzothiophen-2-yl)-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide (PubChem CID 23589752) has the molecular formula C22H17N3O2S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide.
| Compound Name | 3-(1-benzothiophen-2-yl)-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 23589752 |
| Molecular Formula | C22H17N3O2S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide |
| SMILES | COc1c(C(=O)NCc2cccs2)ccc2[nH]nc(-c3cc4ccccc4s3)c12 |
| InChI | InChI=1S/C22H17N3O2S2/c1-27-21-15(22(26)23-12-14-6-4-10-28-14)8-9-16-19(21)20(25-24-16)18-11-13-5-2-3-7-17(13)29-18/h2-11H,12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | CJGHNNILWLDPIB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |