C40H45BN- — CID 23591308
butyl-[4-(N-phenylanilino)phenyl]-bis(2,4,6-trimethylphenyl)boranuide (PubChem CID 23591308) has the molecular formula C40H45BN- and a molecular weight of 550.62 g/mol. Its IUPAC name is butyl-[4-(N-phenylanilino)phenyl]-bis(2,4,6-trimethylphenyl)boranuide.
| Compound Name | butyl-[4-(N-phenylanilino)phenyl]-bis(2,4,6-trimethylphenyl)boranuide |
|---|---|
| PubChem CID | 23591308 |
| Molecular Formula | C40H45BN- |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | butyl-[4-(N-phenylanilino)phenyl]-bis(2,4,6-trimethylphenyl)boranuide |
| SMILES | CCCC[B-](c1ccc(N(c2ccccc2)c2ccccc2)cc1)(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C40H45BN/c1-8-9-24-41(39-31(4)25-29(2)26-32(39)5,40-33(6)27-30(3)28-34(40)7)35-20-22-38(23-21-35)42(36-16-12-10-13-17-36)37-18-14-11-15-19-37/h10-23,25-28H,8-9,24H2,1-7H3/q-1 |
| InChIKey | GGGMFRBNSICBID-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|