C25H15F3IrN2S-2 — CID 23593031
2-(3H-1-benzothiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine (PubChem CID 23593031) has the molecular formula C25H15F3IrN2S-2 and a molecular weight of 624.69 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 23593031 |
| Molecular Formula | C25H15F3IrN2S-2 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine |
| SMILES | FC(F)(F)c1ccc(-c2[c-]c3ccccc3s2)nc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C14H7F3NS.C11H8N.Ir/c15-14(16,17)10-5-6-11(18-8-10)13-7-9-3-1-2-4-12(9)19-13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-6,8H;1-6,8-9H;/q2*-1; |
| InChIKey | KPZBJXOXCAYOAU-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|