C21H12F6IrN2-2 — CID 59005724
2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 59005724) has the molecular formula C21H12F6IrN2-2 and a molecular weight of 598.55 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 59005724 |
| Molecular Formula | C21H12F6IrN2-2 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 599.05 |
| IUPAC Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | FC1(F)[C-]=C(c2ccccn2)C(F)(F)C1(F)F.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C10H4F6N.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;11-8(12)5-6(7-3-1-2-4-17-7)9(13,14)10(8,15)16;/h1-6,8-9H;1-4H;/q2*-1; |
| InChIKey | GKFQGTRQUWECDP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|