About chloroplatinum;2,6-dipyridin-2-ylpyridine
chloroplatinum;2,6-dipyridin-2-ylpyridine (PubChem CID 4319701) has the molecular formula C15H11ClN3Pt
and a molecular weight of 463.81 g/mol. Its IUPAC name is chloroplatinum;2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | chloroplatinum;2,6-dipyridin-2-ylpyridine |
| PubChem CID | 4319701 |
| Molecular Formula | C15H11ClN3Pt |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | chloroplatinum;2,6-dipyridin-2-ylpyridine |
| SMILES | Cl[Pt].c1ccc(-c2cccc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C15H11N3.ClH.Pt/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13;;/h1-11H;1H;/q;;+1/p-1 |
| InChIKey | FCCOONUXEYKJHA-UHFFFAOYSA-M |
| XLogP | 3.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze chloroplatinum;2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum;2,6-dipyridin-2-ylpyridine?
The IUPAC name of chloroplatinum;2,6-dipyridin-2-ylpyridine (CID 4319701) is chloroplatinum;2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for chloroplatinum;2,6-dipyridin-2-ylpyridine?
The canonical SMILES for chloroplatinum;2,6-dipyridin-2-ylpyridine is Cl[Pt].c1ccc(-c2cccc(-c3ccccn3)n2)nc1.
What is the InChIKey of chloroplatinum;2,6-dipyridin-2-ylpyridine?
The InChIKey is FCCOONUXEYKJHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H11N3.ClH.Pt/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13;;/h1-11H;1H;/q;;+1/p-1.
What are the key properties of chloroplatinum;2,6-dipyridin-2-ylpyridine?
chloroplatinum;2,6-dipyridin-2-ylpyridine has a molecular weight of 463.81 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum;2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 4319701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).