About 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine (PubChem CID 23593032) has the molecular formula C22H14IrN2S2-2
and a molecular weight of 562.72 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine |
| PubChem CID | 23593032 |
| Molecular Formula | C22H14IrN2S2-2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine |
| SMILES | [Ir].[c-]1c(-c2ccccn2)sc2ccccc12.[c-]1ccsc1-c1ccccn1 |
| InChI | InChI=1S/C13H8NS.C9H6NS.Ir/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;1-2-6-10-8(4-1)9-5-3-7-11-9;/h1-8H;1-4,6-7H;/q2*-1; |
| InChIKey | KLEWGIPZWBLDFO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
The IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine (CID 23593032) is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine.
What is the SMILES notation for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
The canonical SMILES for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine is [Ir].[c-]1c(-c2ccccn2)sc2ccccc12.[c-]1ccsc1-c1ccccn1.
What is the InChIKey of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
The InChIKey is KLEWGIPZWBLDFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8NS.C9H6NS.Ir/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;1-2-6-10-8(4-1)9-5-3-7-11-9;/h1-8H;1-4,6-7H;/q2*-1;.
What are the key properties of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine has a molecular weight of 562.72 g/mol, XLogP of 6.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;2-(3H-thiophen-3-id-2-yl)pyridine is sourced from PubChem (CID 23593032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).