About bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+)
bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) (PubChem CID 23597305) has the molecular formula C26H20N4Pt
and a molecular weight of 583.55 g/mol. Its IUPAC name is bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+).
Molecular Properties
| Compound Name | bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) |
| PubChem CID | 23597305 |
| Molecular Formula | C26H20N4Pt |
| Molecular Weight | 583.55 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) |
| SMILES | Cc1ccc(-c2ccc(C)cn2)nc1.[C-]#Cc1ccncc1.[C-]#Cc1ccncc1.[Pt+2] |
| InChI | InChI=1S/C12H12N2.2C7H4N.Pt/c1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12;2*1-2-7-3-5-8-6-4-7;/h3-8H,1-2H3;2*3-6H;/q;2*-1;+2 |
| InChIKey | ILNRSRYFKMRPON-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 583.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+)?
The IUPAC name of bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) (CID 23597305) is bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+).
What is the SMILES notation for bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+)?
The canonical SMILES for bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) is Cc1ccc(-c2ccc(C)cn2)nc1.[C-]#Cc1ccncc1.[C-]#Cc1ccncc1.[Pt+2].
What is the InChIKey of bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+)?
The InChIKey is ILNRSRYFKMRPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.2C7H4N.Pt/c1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12;2*1-2-7-3-5-8-6-4-7;/h3-8H,1-2H3;2*3-6H;/q;2*-1;+2.
What are the key properties of bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+)?
bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) has a molecular weight of 583.55 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-ethynylpyridine);5-methyl-2-(5-methyl-2-pyridinyl)pyridine;platinum(2+) is sourced from PubChem (CID 23597305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).