About 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine
9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine (PubChem CID 23597819) has the molecular formula C28H26N2O
and a molecular weight of 406.53 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine.
Molecular Properties
| Compound Name | 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine |
| PubChem CID | 23597819 |
| Molecular Formula | C28H26N2O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine |
| SMILES | COc1ccc(-n2c3ccc(C)cc3c3cc(N(C)c4cccc(C)c4)ccc32)cc1 |
| InChI | InChI=1S/C28H26N2O/c1-19-6-5-7-22(16-19)29(3)23-11-15-28-26(18-23)25-17-20(2)8-14-27(25)30(28)21-9-12-24(31-4)13-10-21/h5-18H,1-4H3 |
| InChIKey | OLSMTSMWRYNWTR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine?
The IUPAC name of 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine (CID 23597819) is 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine.
What is the SMILES notation for 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine?
The canonical SMILES for 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine is COc1ccc(-n2c3ccc(C)cc3c3cc(N(C)c4cccc(C)c4)ccc32)cc1.
What is the InChIKey of 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine?
The InChIKey is OLSMTSMWRYNWTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O/c1-19-6-5-7-22(16-19)29(3)23-11-15-28-26(18-23)25-17-20(2)8-14-27(25)30(28)21-9-12-24(31-4)13-10-21/h5-18H,1-4H3.
What are the key properties of 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine?
9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine has a molecular weight of 406.53 g/mol, XLogP of 7.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-methoxyphenyl)-N,6-dimethyl-N-(3-methylphenyl)carbazol-3-amine is sourced from PubChem (CID 23597819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).