C15H23IO5 — CID 23598251
2-[2-[2-[2-[(4-iodophenyl)methoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 23598251) has the molecular formula C15H23IO5 and a molecular weight of 410.25 g/mol. Its IUPAC name is 2-[2-[2-[2-[(4-iodophenyl)methoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[(4-iodophenyl)methoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 23598251 |
| Molecular Formula | C15H23IO5 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-[2-[2-[2-[(4-iodophenyl)methoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCOCc1ccc(I)cc1 |
| InChI | InChI=1S/C15H23IO5/c16-15-3-1-14(2-4-15)13-21-12-11-20-10-9-19-8-7-18-6-5-17/h1-4,17H,5-13H2 |
| InChIKey | XCAXSJBSWXGOHE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|