C12H22O3 — CID 23599528
(3S)-2,2-dimethyl-3-[(2S)-oxan-2-yl]oxypent-4-en-1-ol (PubChem CID 23599528) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-[(2S)-oxan-2-yl]oxypent-4-en-1-ol.
| Compound Name | (3S)-2,2-dimethyl-3-[(2S)-oxan-2-yl]oxypent-4-en-1-ol |
|---|---|
| PubChem CID | 23599528 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (3S)-2,2-dimethyl-3-[(2S)-oxan-2-yl]oxypent-4-en-1-ol |
| SMILES | C=C[C@H](O[C@H]1CCCCO1)C(C)(C)CO |
| InChI | InChI=1S/C12H22O3/c1-4-10(12(2,3)9-13)15-11-7-5-6-8-14-11/h4,10-11,13H,1,5-9H2,2-3H3/t10-,11-/m0/s1 |
| InChIKey | ZDVKXVQHYCKLHG-QWRGUYRKSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|