C14H26O3 — CID 11042919
(5S)-4,4-dimethyl-5-(oxan-2-yloxy)hept-6-en-3-ol (PubChem CID 11042919) has the molecular formula C14H26O3 and a molecular weight of 242.35 g/mol. Its IUPAC name is (5S)-4,4-dimethyl-5-(oxan-2-yloxy)hept-6-en-3-ol.
| Compound Name | (5S)-4,4-dimethyl-5-(oxan-2-yloxy)hept-6-en-3-ol |
|---|---|
| PubChem CID | 11042919 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (5S)-4,4-dimethyl-5-(oxan-2-yloxy)hept-6-en-3-ol |
| SMILES | CCC(C(C)(C)[C@H](C=C)OC1CCCCO1)O |
| InChI | InChI=1S/C14H26O3/c1-5-11(15)14(3,4)12(6-2)17-13-9-7-8-10-16-13/h6,11-13,15H,2,5,7-10H2,1,3-4H3/t11?,12-,13?/m0/s1 |
| InChIKey | DDQYRFIWZWPNHE-CPCZMJQVSA-N |
| XLogP | 3.10 |
| TPSA | 38.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 238 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|