C24H26N4O5 — CID 23602329
N'-(2,4-dimethoxyphenyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide (PubChem CID 23602329) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide.
| Compound Name | N'-(2,4-dimethoxyphenyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide |
|---|---|
| PubChem CID | 23602329 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide |
| SMILES | COc1ccc(N(C)C(=O)C(=O)Nc2ccc3nc4n(c(=O)c3c2)CCCCC4)c(OC)c1 |
| InChI | InChI=1S/C24H26N4O5/c1-27(19-11-9-16(32-2)14-20(19)33-3)24(31)22(29)25-15-8-10-18-17(13-15)23(30)28-12-6-4-5-7-21(28)26-18/h8-11,13-14H,4-7,12H2,1-3H3,(H,25,29) |
| InChIKey | CQMFBTQRVSKCGY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|