C16H19N3OS2 — CID 2360344
2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-3-methylcyclohexen-1-yl]acetohydrazide (PubChem CID 2360344) has the molecular formula C16H19N3OS2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-3-methylcyclohexen-1-yl]acetohydrazide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-3-methylcyclohexen-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 2360344 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N'-[(3R)-3-methylcyclohexen-1-yl]acetohydrazide |
| SMILES | C[C@H]1C=C(NNC(=O)CSc2nc3ccccc3s2)CCC1 |
| InChI | InChI=1S/C16H19N3OS2/c1-11-5-4-6-12(9-11)18-19-15(20)10-21-16-17-13-7-2-3-8-14(13)22-16/h2-3,7-9,11,18H,4-6,10H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | UKJRPEYFKKHNKG-LLVKDONJSA-N |
| XLogP | 3.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|