C19H16N4S — CID 23606738
8-ethyl-2-pyridin-4-yl-4-thiophen-2-yl-1H-1,3,5-benzotriazepine (PubChem CID 23606738) has the molecular formula C19H16N4S and a molecular weight of 332.43 g/mol. Its IUPAC name is 8-ethyl-2-pyridin-4-yl-4-thiophen-2-yl-1H-1,3,5-benzotriazepine.
| Compound Name | 8-ethyl-2-pyridin-4-yl-4-thiophen-2-yl-1H-1,3,5-benzotriazepine |
|---|---|
| PubChem CID | 23606738 |
| Molecular Formula | C19H16N4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 8-ethyl-2-pyridin-4-yl-4-thiophen-2-yl-1H-1,3,5-benzotriazepine |
| SMILES | CCc1ccc2c(c1)NC(c1ccncc1)=NC(c1cccs1)=N2 |
| InChI | InChI=1S/C19H16N4S/c1-2-13-5-6-15-16(12-13)22-18(14-7-9-20-10-8-14)23-19(21-15)17-4-3-11-24-17/h3-12H,2H2,1H3,(H,21,22,23) |
| InChIKey | DXOFMTXHCMMTFT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |