C20H22N2OS — CID 23613754
2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-1-prop-2-enylbenzimidazole (PubChem CID 23613754) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-1-prop-2-enylbenzimidazole.
| Compound Name | 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-1-prop-2-enylbenzimidazole |
|---|---|
| PubChem CID | 23613754 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-1-prop-2-enylbenzimidazole |
| SMILES | C=CCn1c(SCCOc2ccc(C)c(C)c2)nc2ccccc21 |
| InChI | InChI=1S/C20H22N2OS/c1-4-11-22-19-8-6-5-7-18(19)21-20(22)24-13-12-23-17-10-9-15(2)16(3)14-17/h4-10,14H,1,11-13H2,2-3H3 |
| InChIKey | SEVOBSLFKCZJSZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|