About 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone
1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 23615895) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone |
| PubChem CID | 23615895 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CCOC1=CCC(N)(C(C)=O)C=C1 |
| InChI | InChI=1S/C10H15NO2/c1-3-13-9-4-6-10(11,7-5-9)8(2)12/h4-6H,3,7,11H2,1-2H3 |
| InChIKey | YGDDHYMEJILHCM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone?
The IUPAC name of 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone (CID 23615895) is 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone.
What is the SMILES notation for 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone?
The canonical SMILES for 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone is CCOC1=CCC(N)(C(C)=O)C=C1.
What is the InChIKey of 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone?
The InChIKey is YGDDHYMEJILHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-3-13-9-4-6-10(11,7-5-9)8(2)12/h4-6H,3,7,11H2,1-2H3.
What are the key properties of 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone?
1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone has a molecular weight of 181.23 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-amino-4-ethoxycyclohexa-2,4-dien-1-yl)ethanone is sourced from PubChem (CID 23615895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).