C11H16N4O4S — CID 23616816
(2R,3S,4R)-2-(hydroxymethyl)-5-(6-methyl-6-sulfanyl-3H-purin-9-yl)oxolane-3,4-diol (PubChem CID 23616816) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-(6-methyl-6-sulfanyl-3H-purin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(6-methyl-6-sulfanyl-3H-purin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 23616816 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(6-methyl-6-sulfanyl-3H-purin-9-yl)oxolane-3,4-diol |
| SMILES | CC1(S)N=CNc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H16N4O4S/c1-11(20)8-9(12-3-14-11)15(4-13-8)10-7(18)6(17)5(2-16)19-10/h3-7,10,16-18,20H,2H2,1H3,(H,12,14)/t5-,6-,7-,10?,11?/m1/s1 |
| InChIKey | BBCIGHSCLDEWOX-QNNRPDIMSA-N |
| XLogP | -0.95 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|