C19H29N5O5Si — CID 70630466
(2R,3R,4S,5R)-2-[6-amino-6-tris(prop-2-enyl)silyloxy-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 70630466) has the molecular formula C19H29N5O5Si and a molecular weight of 435.56 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-6-tris(prop-2-enyl)silyloxy-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-6-tris(prop-2-enyl)silyloxy-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70630466 |
| Molecular Formula | C19H29N5O5Si |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-6-tris(prop-2-enyl)silyloxy-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C=CC[Si](CC=C)(CC=C)OC1(N)N=CNc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H29N5O5Si/c1-4-7-30(8-5-2,9-6-3)29-19(20)16-17(21-11-23-19)24(12-22-16)18-15(27)14(26)13(10-25)28-18/h4-6,11-15,18,25-27H,1-3,7-10,20H2,(H,21,23)/t13-,14-,15-,18-,19?/m1/s1 |
| InChIKey | YBRZYKQYJBRRSJ-QPOXZDKKSA-N |
| XLogP | 0.54 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|