C6H11N3O4 — CID 23619072
1-(2,3-dihydroxypropyl)-N-hydroxyimidazol-2-amine oxide (PubChem CID 23619072) has the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-N-hydroxyimidazol-2-amine oxide.
| Compound Name | 1-(2,3-dihydroxypropyl)-N-hydroxyimidazol-2-amine oxide |
|---|---|
| PubChem CID | 23619072 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-N-hydroxyimidazol-2-amine oxide |
| SMILES | [O-][NH+](O)c1nccn1CC(O)CO |
| InChI | InChI=1S/C6H11N3O4/c10-4-5(11)3-8-2-1-7-6(8)9(12)13/h1-2,5,9-12H,3-4H2 |
| InChIKey | YUCJLSYFXANPNE-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|