C7H12N2O — CID 23619295
4,6-diamino-6-methylcyclohexa-2,4-dien-1-ol (PubChem CID 23619295) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 4,6-diamino-6-methylcyclohexa-2,4-dien-1-ol.
| Compound Name | 4,6-diamino-6-methylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 23619295 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4,6-diamino-6-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1(N)C=C(N)C=CC1O |
| InChI | InChI=1S/C7H12N2O/c1-7(9)4-5(8)2-3-6(7)10/h2-4,6,10H,8-9H2,1H3 |
| InChIKey | DPSYWSCDUWNPIW-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |