About 3-chlorobenzoic acid;7-nitroquinolin-8-ol
3-chlorobenzoic acid;7-nitroquinolin-8-ol (PubChem CID 23620172) has the molecular formula C16H11ClN2O5
and a molecular weight of 346.73 g/mol. Its IUPAC name is 3-chlorobenzoic acid;7-nitroquinolin-8-ol.
Molecular Properties
| Compound Name | 3-chlorobenzoic acid;7-nitroquinolin-8-ol |
| PubChem CID | 23620172 |
| Molecular Formula | C16H11ClN2O5 |
| Molecular Weight | 346.73 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-chlorobenzoic acid;7-nitroquinolin-8-ol |
| SMILES | O=C(O)c1cccc(Cl)c1.O=[N+]([O-])c1ccc2cccnc2c1O |
| InChI | InChI=1S/C9H6N2O3.C7H5ClO2/c12-9-7(11(13)14)4-3-6-2-1-5-10-8(6)9;8-6-3-1-2-5(4-6)7(9)10/h1-5,12H;1-4H,(H,9,10) |
| InChIKey | TUZRKKCCCGCPGD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzoic acid;7-nitroquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzoic acid;7-nitroquinolin-8-ol?
The IUPAC name of 3-chlorobenzoic acid;7-nitroquinolin-8-ol (CID 23620172) is 3-chlorobenzoic acid;7-nitroquinolin-8-ol.
What is the SMILES notation for 3-chlorobenzoic acid;7-nitroquinolin-8-ol?
The canonical SMILES for 3-chlorobenzoic acid;7-nitroquinolin-8-ol is O=C(O)c1cccc(Cl)c1.O=[N+]([O-])c1ccc2cccnc2c1O.
What is the InChIKey of 3-chlorobenzoic acid;7-nitroquinolin-8-ol?
The InChIKey is TUZRKKCCCGCPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3.C7H5ClO2/c12-9-7(11(13)14)4-3-6-2-1-5-10-8(6)9;8-6-3-1-2-5(4-6)7(9)10/h1-5,12H;1-4H,(H,9,10).
What are the key properties of 3-chlorobenzoic acid;7-nitroquinolin-8-ol?
3-chlorobenzoic acid;7-nitroquinolin-8-ol has a molecular weight of 346.73 g/mol, XLogP of 3.89, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzoic acid;7-nitroquinolin-8-ol is sourced from PubChem (CID 23620172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).