C17H23BrClNO4 — CID 23620411
1-(diethylamino)ethyl 5-bromo-6-methoxy-3-methyl-1-benzofuran-2-carboxylate;hydrochloride (PubChem CID 23620411) has the molecular formula C17H23BrClNO4 and a molecular weight of 420.73 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 5-bromo-6-methoxy-3-methyl-1-benzofuran-2-carboxylate;hydrochloride.
| Compound Name | 1-(diethylamino)ethyl 5-bromo-6-methoxy-3-methyl-1-benzofuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 23620411 |
| Molecular Formula | C17H23BrClNO4 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-(diethylamino)ethyl 5-bromo-6-methoxy-3-methyl-1-benzofuran-2-carboxylate;hydrochloride |
| SMILES | CCN(CC)C(C)OC(=O)c1oc2cc(OC)c(Br)cc2c1C.Cl |
| InChI | InChI=1S/C17H22BrNO4.ClH/c1-6-19(7-2)11(4)22-17(20)16-10(3)12-8-13(18)15(21-5)9-14(12)23-16;/h8-9,11H,6-7H2,1-5H3;1H |
| InChIKey | OHTBOMHKLTVYCH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|