About 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane
2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane (PubChem CID 23621119) has the molecular formula C22H20IN3O3
and a molecular weight of 501.32 g/mol. Its IUPAC name is 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane.
Molecular Properties
| Compound Name | 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane |
| PubChem CID | 23621119 |
| Molecular Formula | C22H20IN3O3 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane |
| SMILES | CCOc1ccc2nc3cc([N+](=O)[O-])ccc3c(Cc3ccncc3)c2c1.CI |
| InChI | InChI=1S/C21H17N3O3.CH3I/c1-2-27-16-4-6-20-19(13-16)18(11-14-7-9-22-10-8-14)17-5-3-15(24(25)26)12-21(17)23-20;1-2/h3-10,12-13H,2,11H2,1H3;1H3 |
| InChIKey | GBMKZBJAPURDFN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane?
The IUPAC name of 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane (CID 23621119) is 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane.
What is the SMILES notation for 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane?
The canonical SMILES for 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane is CCOc1ccc2nc3cc([N+](=O)[O-])ccc3c(Cc3ccncc3)c2c1.CI.
What is the InChIKey of 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane?
The InChIKey is GBMKZBJAPURDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O3.CH3I/c1-2-27-16-4-6-20-19(13-16)18(11-14-7-9-22-10-8-14)17-5-3-15(24(25)26)12-21(17)23-20;1-2/h3-10,12-13H,2,11H2,1H3;1H3.
What are the key properties of 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane?
2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane has a molecular weight of 501.32 g/mol, XLogP of 5.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-nitro-9-(pyridin-4-ylmethyl)acridine;iodomethane is sourced from PubChem (CID 23621119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).