C15H15N3O5 — CID 170245037
7-ethoxy-3-N,3-N,9-N,9-N-tetrahydroxyacridine-3,9-diamine (PubChem CID 170245037) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is 7-ethoxy-3-N,3-N,9-N,9-N-tetrahydroxyacridine-3,9-diamine.
| Compound Name | 7-ethoxy-3-N,3-N,9-N,9-N-tetrahydroxyacridine-3,9-diamine |
|---|---|
| PubChem CID | 170245037 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 7-ethoxy-3-N,3-N,9-N,9-N-tetrahydroxyacridine-3,9-diamine |
| SMILES | CCOc1ccc2nc3cc(N(O)O)ccc3c(N(O)O)c2c1 |
| InChI | InChI=1S/C15H15N3O5/c1-2-23-10-4-6-13-12(8-10)15(18(21)22)11-5-3-9(17(19)20)7-14(11)16-13/h3-8,19-22H,2H2,1H3 |
| InChIKey | CQUMYSWCGJBGTG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|