C18H21N3O — CID 10685301
7-ethoxy-9-N-propylacridine-3,9-diamine (PubChem CID 10685301) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 7-ethoxy-9-N-propylacridine-3,9-diamine.
| Compound Name | 7-ethoxy-9-N-propylacridine-3,9-diamine |
|---|---|
| PubChem CID | 10685301 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 7-ethoxy-9-N-propylacridine-3,9-diamine |
| SMILES | CCCNc1c2ccc(N)cc2nc2ccc(OCC)cc12 |
| InChI | InChI=1S/C18H21N3O/c1-3-9-20-18-14-7-5-12(19)10-17(14)21-16-8-6-13(22-4-2)11-15(16)18/h5-8,10-11H,3-4,9,19H2,1-2H3,(H,20,21) |
| InChIKey | GZELABAPOQCQBD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|