C18H18ClNO4S — CID 23621339
4-[(4-chlorophenyl)methyl]-7-methoxyisoquinoline;methanesulfonic acid (PubChem CID 23621339) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-7-methoxyisoquinoline;methanesulfonic acid.
| Compound Name | 4-[(4-chlorophenyl)methyl]-7-methoxyisoquinoline;methanesulfonic acid |
|---|---|
| PubChem CID | 23621339 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-7-methoxyisoquinoline;methanesulfonic acid |
| SMILES | COc1ccc2c(Cc3ccc(Cl)cc3)cncc2c1.CS(=O)(=O)O |
| InChI | InChI=1S/C17H14ClNO.CH4O3S/c1-20-16-6-7-17-13(10-19-11-14(17)9-16)8-12-2-4-15(18)5-3-12;1-5(2,3)4/h2-7,9-11H,8H2,1H3;1H3,(H,2,3,4) |
| InChIKey | CWCCDFMOZLVKMC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|