C16H25IN2O4 — CID 23622666
ethyl 4-[[2-(diethylamino)acetyl]amino]-2-hydroxybenzoate;iodomethane (PubChem CID 23622666) has the molecular formula C16H25IN2O4 and a molecular weight of 436.29 g/mol. Its IUPAC name is ethyl 4-[[2-(diethylamino)acetyl]amino]-2-hydroxybenzoate;iodomethane.
| Compound Name | ethyl 4-[[2-(diethylamino)acetyl]amino]-2-hydroxybenzoate;iodomethane |
|---|---|
| PubChem CID | 23622666 |
| Molecular Formula | C16H25IN2O4 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | ethyl 4-[[2-(diethylamino)acetyl]amino]-2-hydroxybenzoate;iodomethane |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(CC)CC)cc1O.CI |
| InChI | InChI=1S/C15H22N2O4.CH3I/c1-4-17(5-2)10-14(19)16-11-7-8-12(13(18)9-11)15(20)21-6-3;1-2/h7-9,18H,4-6,10H2,1-3H3,(H,16,19);1H3 |
| InChIKey | AUKONJGXZMLYIZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|