C20H30N2O6 — CID 15568065
diethyl 5-[[2-(diethylamino)acetyl]amino]-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate (PubChem CID 15568065) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is diethyl 5-[[2-(diethylamino)acetyl]amino]-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[2-(diethylamino)acetyl]amino]-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15568065 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | diethyl 5-[[2-(diethylamino)acetyl]amino]-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)c(NC(=O)CN(CC)CC)c(C)c(C(=O)OCC)c1O |
| InChI | InChI=1S/C20H30N2O6/c1-7-22(8-2)11-14(23)21-17-12(5)15(19(25)27-9-3)18(24)16(13(17)6)20(26)28-10-4/h24H,7-11H2,1-6H3,(H,21,23) |
| InChIKey | CDRQQOQBNPRVSH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|