C22H34N2O3 — CID 23622878
4-aminobenzoic acid;(1R,2R,3R,4S)-4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]heptan-2-ol (PubChem CID 23622878) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 4-aminobenzoic acid;(1R,2R,3R,4S)-4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 4-aminobenzoic acid;(1R,2R,3R,4S)-4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 23622878 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 4-aminobenzoic acid;(1R,2R,3R,4S)-4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](N1CCCCC1)[C@@H]2O.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H27NO.C7H7NO2/c1-14(2)11-7-8-15(14,3)13(12(11)17)16-9-5-4-6-10-16;8-6-3-1-5(2-4-6)7(9)10/h11-13,17H,4-10H2,1-3H3;1-4H,8H2,(H,9,10)/t11-,12+,13-,15+;/m0./s1 |
| InChIKey | JGDKWMRTIZQIRT-GQSJMVAASA-N |
| XLogP | 3.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|