C10H24NO2PS — CID 23624184
(1S)-1-[ethoxy(ethyl)phosphoryl]sulfanyl-N,N-diethylethanamine (PubChem CID 23624184) has the molecular formula C10H24NO2PS and a molecular weight of 253.35 g/mol. Its IUPAC name is (1S)-1-[ethoxy(ethyl)phosphoryl]sulfanyl-N,N-diethylethanamine.
| Compound Name | (1S)-1-[ethoxy(ethyl)phosphoryl]sulfanyl-N,N-diethylethanamine |
|---|---|
| PubChem CID | 23624184 |
| Molecular Formula | C10H24NO2PS |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (1S)-1-[ethoxy(ethyl)phosphoryl]sulfanyl-N,N-diethylethanamine |
| SMILES | CCOP(=O)(CC)S[C@@H](C)N(CC)CC |
| InChI | InChI=1S/C10H24NO2PS/c1-6-11(7-2)10(5)15-14(12,9-4)13-8-3/h10H,6-9H2,1-5H3/t10-,14?/m0/s1 |
| InChIKey | SIERQTXISDRKQV-XLLULAGJSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|