C21H29N3O5S — CID 23625454
4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-N-hydroxy-1-(2-methylpropanoyl)piperidine-4-carboxamide (PubChem CID 23625454) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-N-hydroxy-1-(2-methylpropanoyl)piperidine-4-carboxamide.
| Compound Name | 4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-N-hydroxy-1-(2-methylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23625454 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-N-hydroxy-1-(2-methylpropanoyl)piperidine-4-carboxamide |
| SMILES | CC#CCNc1ccc(S(=O)(=O)CC2(C(=O)NO)CCN(C(=O)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-4-5-12-22-17-6-8-18(9-7-17)30(28,29)15-21(20(26)23-27)10-13-24(14-11-21)19(25)16(2)3/h6-9,16,22,27H,10-15H2,1-3H3,(H,23,26) |
| InChIKey | DYUKSKSACQYNBM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|