C16H21IN2O — CID 23625692
6-[[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]methoxy]quinoline iodide (PubChem CID 23625692) has the molecular formula C16H21IN2O and a molecular weight of 384.26 g/mol. Its IUPAC name is 6-[[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]methoxy]quinoline iodide.
| Compound Name | 6-[[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]methoxy]quinoline iodide |
|---|---|
| PubChem CID | 23625692 |
| Molecular Formula | C16H21IN2O |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 6-[[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]methoxy]quinoline iodide |
| SMILES | C[N+]1(C)CCC[C@@H]1COc1ccc2ncccc2c1.[I-] |
| InChI | InChI=1S/C16H21N2O.HI/c1-18(2)10-4-6-14(18)12-19-15-7-8-16-13(11-15)5-3-9-17-16;/h3,5,7-9,11,14H,4,6,10,12H2,1-2H3;1H/q+1;/p-1/t14-;/m1./s1 |
| InChIKey | YKISWCNIHWBEDY-PFEQFJNWSA-M |
| XLogP | -0.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|