C34H50N6O2 — CID 23626289
2,5-bis[6-[ethyl(pyridin-4-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 23626289) has the molecular formula C34H50N6O2 and a molecular weight of 574.81 g/mol. Its IUPAC name is 2,5-bis[6-[ethyl(pyridin-4-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[6-[ethyl(pyridin-4-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 23626289 |
| Molecular Formula | C34H50N6O2 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.40 |
| IUPAC Name | 2,5-bis[6-[ethyl(pyridin-4-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCCCCNC1=CC(=O)C(NCCCCCCN(CC)Cc2ccncc2)=CC1=O)Cc1ccncc1 |
| InChI | InChI=1S/C34H50N6O2/c1-3-39(27-29-13-19-35-20-14-29)23-11-7-5-9-17-37-31-25-34(42)32(26-33(31)41)38-18-10-6-8-12-24-40(4-2)28-30-15-21-36-22-16-30/h13-16,19-22,25-26,37-38H,3-12,17-18,23-24,27-28H2,1-2H3 |
| InChIKey | PBZSJALBPJPRTC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|