C24H32N4O9 — CID 23626309
dimethyl (E)-2-[(Z)-[amino-[(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidin-2-yl]methylidene]amino]oxybut-2-enedioate (PubChem CID 23626309) has the molecular formula C24H32N4O9 and a molecular weight of 520.54 g/mol. Its IUPAC name is dimethyl (E)-2-[(Z)-[amino-[(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidin-2-yl]methylidene]amino]oxybut-2-enedioate.
| Compound Name | dimethyl (E)-2-[(Z)-[amino-[(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidin-2-yl]methylidene]amino]oxybut-2-enedioate |
|---|---|
| PubChem CID | 23626309 |
| Molecular Formula | C24H32N4O9 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | dimethyl (E)-2-[(Z)-[amino-[(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidin-2-yl]methylidene]amino]oxybut-2-enedioate |
| SMILES | COC(=O)/C=C(/O/N=C(\N)[C@@H]1C[C@H](NC(=O)OC(C)(C)C)CN1C(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H32N4O9/c1-24(2,3)36-22(31)26-16-11-17(20(25)27-37-18(21(30)34-5)12-19(29)33-4)28(13-16)23(32)35-14-15-9-7-6-8-10-15/h6-10,12,16-17H,11,13-14H2,1-5H3,(H2,25,27)(H,26,31)/b18-12+/t16-,17-/m0/s1 |
| InChIKey | NEYQWMRVHIFDQB-JXELUCIISA-N |
| XLogP | 1.81 |
| TPSA | 168.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|