C17H16N2O — CID 23627984
3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)prop-2-ynamide (PubChem CID 23627984) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)prop-2-ynamide.
| Compound Name | 3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)prop-2-ynamide |
|---|---|
| PubChem CID | 23627984 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)prop-2-ynamide |
| SMILES | Cc1cccc(C#CC(=O)NCCc2ccccn2)c1 |
| InChI | InChI=1S/C17H16N2O/c1-14-5-4-6-15(13-14)8-9-17(20)19-12-10-16-7-2-3-11-18-16/h2-7,11,13H,10,12H2,1H3,(H,19,20) |
| InChIKey | PCKUFXSCJFVWMC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|