C21H15NO3S — CID 23629330
(12S,16S,17R)-17-hydroxy-14-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8-pentaene-13,15-dione (PubChem CID 23629330) has the molecular formula C21H15NO3S and a molecular weight of 361.42 g/mol. Its IUPAC name is (12S,16S,17R)-17-hydroxy-14-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8-pentaene-13,15-dione.
| Compound Name | (12S,16S,17R)-17-hydroxy-14-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8-pentaene-13,15-dione |
|---|---|
| PubChem CID | 23629330 |
| Molecular Formula | C21H15NO3S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (12S,16S,17R)-17-hydroxy-14-phenyl-11-thia-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8-pentaene-13,15-dione |
| SMILES | O=C1[C@H]2[C@H](Sc3ccc4ccccc4c3[C@@H]2O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H15NO3S/c23-18-16-14-9-5-4-6-12(14)10-11-15(16)26-19-17(18)20(24)22(21(19)25)13-7-2-1-3-8-13/h1-11,17-19,23H/t17-,18+,19+/m1/s1 |
| InChIKey | XYUVVAAKTYLAEP-QYZOEREBSA-N |
| XLogP | 3.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|