C15H27N3O2 — CID 23629744
2-(2-oxo-1,3-dihydroimidazol-4-yl)-N,N-dipentylacetamide (PubChem CID 23629744) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroimidazol-4-yl)-N,N-dipentylacetamide.
| Compound Name | 2-(2-oxo-1,3-dihydroimidazol-4-yl)-N,N-dipentylacetamide |
|---|---|
| PubChem CID | 23629744 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 2-(2-oxo-1,3-dihydroimidazol-4-yl)-N,N-dipentylacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)Cc1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C15H27N3O2/c1-3-5-7-9-18(10-8-6-4-2)14(19)11-13-12-16-15(20)17-13/h12H,3-11H2,1-2H3,(H2,16,17,20) |
| InChIKey | NHOUSKIEFKYTSU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|