C19H16ClN3O2S — CID 23630122
2-chloro-5-[(3,5-dimethylbenzoyl)amino]-N-(1,3-thiazol-5-yl)benzamide (PubChem CID 23630122) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is 2-chloro-5-[(3,5-dimethylbenzoyl)amino]-N-(1,3-thiazol-5-yl)benzamide.
| Compound Name | 2-chloro-5-[(3,5-dimethylbenzoyl)amino]-N-(1,3-thiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 23630122 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-chloro-5-[(3,5-dimethylbenzoyl)amino]-N-(1,3-thiazol-5-yl)benzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2ccc(Cl)c(C(=O)Nc3cncs3)c2)c1 |
| InChI | InChI=1S/C19H16ClN3O2S/c1-11-5-12(2)7-13(6-11)18(24)22-14-3-4-16(20)15(8-14)19(25)23-17-9-21-10-26-17/h3-10H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | ZLFBFXIWLVCQQD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |