C28H50O6 — CID 23630433
(2R,3R,4R,6R,8S,9S,11S)-2-[(E,2R,3S,4S)-3-hydroxy-4,6-dimethyloct-6-en-2-yl]-8-[(2S,3R)-3-hydroxy-4-methylpent-4-en-2-yl]-4-methoxy-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-11-ol (PubChem CID 23630433) has the molecular formula C28H50O6 and a molecular weight of 482.70 g/mol. Its IUPAC name is (2R,3R,4R,6R,8S,9S,11S)-2-[(E,2R,3S,4S)-3-hydroxy-4,6-dimethyloct-6-en-2-yl]-8-[(2S,3R)-3-hydroxy-4-methylpent-4-en-2-yl]-4-methoxy-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-11-ol.
| Compound Name | (2R,3R,4R,6R,8S,9S,11S)-2-[(E,2R,3S,4S)-3-hydroxy-4,6-dimethyloct-6-en-2-yl]-8-[(2S,3R)-3-hydroxy-4-methylpent-4-en-2-yl]-4-methoxy-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-11-ol |
|---|---|
| PubChem CID | 23630433 |
| Molecular Formula | C28H50O6 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | (2R,3R,4R,6R,8S,9S,11S)-2-[(E,2R,3S,4S)-3-hydroxy-4,6-dimethyloct-6-en-2-yl]-8-[(2S,3R)-3-hydroxy-4-methylpent-4-en-2-yl]-4-methoxy-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-11-ol |
| SMILES | C=C(C)[C@H](O)[C@H](C)[C@H]1O[C@@]2(C[C@@H](OC)[C@@H](C)[C@@H]([C@H](C)[C@@H](O)[C@@H](C)C/C(C)=C/C)O2)[C@@H](O)C[C@@H]1C |
| InChI | InChI=1S/C28H50O6/c1-11-16(4)12-17(5)25(31)21(9)27-19(7)22(32-10)14-28(34-27)23(29)13-18(6)26(33-28)20(8)24(30)15(2)3/h11,17-27,29-31H,2,12-14H2,1,3-10H3/b16-11+/t17-,18-,19+,20-,21+,22+,23-,24-,25-,26-,27-,28+/m0/s1 |
| InChIKey | AMYQSTSTCNYGAT-IMRBJWMESA-N |
| XLogP | 4.47 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|