C24H34O5S — CID 23631862
[(3S,4R,5S,6S)-3-hydroxy-4,6-dimethyl-5-phenylmethoxyoctyl] 4-methylbenzenesulfonate (PubChem CID 23631862) has the molecular formula C24H34O5S and a molecular weight of 434.60 g/mol. Its IUPAC name is [(3S,4R,5S,6S)-3-hydroxy-4,6-dimethyl-5-phenylmethoxyoctyl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4R,5S,6S)-3-hydroxy-4,6-dimethyl-5-phenylmethoxyoctyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23631862 |
| Molecular Formula | C24H34O5S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [(3S,4R,5S,6S)-3-hydroxy-4,6-dimethyl-5-phenylmethoxyoctyl] 4-methylbenzenesulfonate |
| SMILES | CC[C@H](C)[C@H](OCc1ccccc1)[C@H](C)[C@@H](O)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34O5S/c1-5-19(3)24(28-17-21-9-7-6-8-10-21)20(4)23(25)15-16-29-30(26,27)22-13-11-18(2)12-14-22/h6-14,19-20,23-25H,5,15-17H2,1-4H3/t19-,20+,23-,24-/m0/s1 |
| InChIKey | ANWBQCFIFOOOAW-KZTDQWPFSA-N |
| XLogP | 4.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|