C17H10ClF4N5O2 — CID 23634342
1-[4-[(2-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-[6-(trifluoromethyl)pyrimidin-4-yl]urea (PubChem CID 23634342) has the molecular formula C17H10ClF4N5O2 and a molecular weight of 427.75 g/mol. Its IUPAC name is 1-[4-[(2-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-[6-(trifluoromethyl)pyrimidin-4-yl]urea.
| Compound Name | 1-[4-[(2-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-[6-(trifluoromethyl)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 23634342 |
| Molecular Formula | C17H10ClF4N5O2 |
| Molecular Weight | 427.75 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 1-[4-[(2-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-[6-(trifluoromethyl)pyrimidin-4-yl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccnc(Cl)c2)c(F)c1)Nc1cc(C(F)(F)F)ncn1 |
| InChI | InChI=1S/C17H10ClF4N5O2/c18-14-6-10(3-4-23-14)29-12-2-1-9(5-11(12)19)26-16(28)27-15-7-13(17(20,21)22)24-8-25-15/h1-8H,(H2,24,25,26,27,28) |
| InChIKey | OAQQIWRABSMBPZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.75 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|