C17H12ClNO3 — CID 23635406
1-[(4-chlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 23635406) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23635406 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccc(Cl)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C17H12ClNO3/c18-12-7-5-11(6-8-12)9-19-10-14(17(21)22)16(20)13-3-1-2-4-15(13)19/h1-8,10H,9H2,(H,21,22) |
| InChIKey | RFPVZXXXNLRRHN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |