C19H32ClNO — CID 23635993
5-methoxy-N-octyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (PubChem CID 23635993) has the molecular formula C19H32ClNO and a molecular weight of 325.92 g/mol. Its IUPAC name is 5-methoxy-N-octyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride.
| Compound Name | 5-methoxy-N-octyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 23635993 |
| Molecular Formula | C19H32ClNO |
| Molecular Weight | 325.92 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 5-methoxy-N-octyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| SMILES | CCCCCCCCNC1CCc2c(cccc2OC)C1.Cl |
| InChI | InChI=1S/C19H31NO.ClH/c1-3-4-5-6-7-8-14-20-17-12-13-18-16(15-17)10-9-11-19(18)21-2;/h9-11,17,20H,3-8,12-15H2,1-2H3;1H |
| InChIKey | VUTLKJJFDMPOIG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|