C21H38O3Si — CID 23636445
(2E,4E)-6-hydroxy-4-methyl-1-[(1R,4S)-1,2,2-trimethyl-4-triethylsilyloxycyclopentyl]hexa-2,4-dien-1-one (PubChem CID 23636445) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (2E,4E)-6-hydroxy-4-methyl-1-[(1R,4S)-1,2,2-trimethyl-4-triethylsilyloxycyclopentyl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-6-hydroxy-4-methyl-1-[(1R,4S)-1,2,2-trimethyl-4-triethylsilyloxycyclopentyl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 23636445 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (2E,4E)-6-hydroxy-4-methyl-1-[(1R,4S)-1,2,2-trimethyl-4-triethylsilyloxycyclopentyl]hexa-2,4-dien-1-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(C)(C)[C@](C)(C(=O)/C=C/C(C)=C/CO)C1 |
| InChI | InChI=1S/C21H38O3Si/c1-8-25(9-2,10-3)24-18-15-20(5,6)21(7,16-18)19(23)12-11-17(4)13-14-22/h11-13,18,22H,8-10,14-16H2,1-7H3/b12-11+,17-13+/t18-,21-/m0/s1 |
| InChIKey | GLHAIWRYPQVQSR-YCWIXNLTSA-N |
| XLogP | 5.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|