C13H16FN3O2S — CID 2363790
3-[(2-fluorophenoxy)methyl]-4-[(2R)-1-methoxypropan-2-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 2363790) has the molecular formula C13H16FN3O2S and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-[(2-fluorophenoxy)methyl]-4-[(2R)-1-methoxypropan-2-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-fluorophenoxy)methyl]-4-[(2R)-1-methoxypropan-2-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2363790 |
| Molecular Formula | C13H16FN3O2S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-[(2-fluorophenoxy)methyl]-4-[(2R)-1-methoxypropan-2-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | COC[C@@H](C)n1c(COc2ccccc2F)n[nH]c1=S |
| InChI | InChI=1S/C13H16FN3O2S/c1-9(7-18-2)17-12(15-16-13(17)20)8-19-11-6-4-3-5-10(11)14/h3-6,9H,7-8H2,1-2H3,(H,16,20)/t9-/m1/s1 |
| InChIKey | ACYXBQNTHKAMPH-SECBINFHSA-N |
| XLogP | 2.87 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|