C18H22FN3OS — CID 98148433
4-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 98148433) has the molecular formula C18H22FN3OS and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 98148433 |
| Molecular Formula | C18H22FN3OS |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | C[C@H]([C@@H]1C[C@H]2CC[C@H]1C2)n1c(COc2ccccc2F)n[nH]c1=S |
| InChI | InChI=1S/C18H22FN3OS/c1-11(14-9-12-6-7-13(14)8-12)22-17(20-21-18(22)24)10-23-16-5-3-2-4-15(16)19/h2-5,11-14H,6-10H2,1H3,(H,21,24)/t11-,12+,13+,14+/m1/s1 |
| InChIKey | RWGLFPMJGRSQIX-RFGFWPKPSA-N |
| XLogP | 4.66 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|