C17H19NO6S — CID 2364065
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,4-trimethoxybenzoate (PubChem CID 2364065) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 2364065 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCc2cccs2)c(OC)c1OC |
| InChI | InChI=1S/C17H19NO6S/c1-21-13-7-6-12(15(22-2)16(13)23-3)17(20)24-10-14(19)18-9-11-5-4-8-25-11/h4-8H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | YBPJTRZMOYOHQW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |