C15H13F2NO4S — CID 2612480
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethoxy)benzoate (PubChem CID 2612480) has the molecular formula C15H13F2NO4S and a molecular weight of 341.34 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethoxy)benzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2612480 |
| Molecular Formula | C15H13F2NO4S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethoxy)benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC(F)F)cc1)NCc1cccs1 |
| InChI | InChI=1S/C15H13F2NO4S/c16-15(17)22-11-5-3-10(4-6-11)14(20)21-9-13(19)18-8-12-2-1-7-23-12/h1-7,15H,8-9H2,(H,18,19) |
| InChIKey | OHIODIJJMOGCTH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |